Ramelteon Impurity 13
Ramelteon Impurity 13 is an impurity of Ramelteon. Ramelteon is a potent and selective agonist at melatonin MT1/MT2 receptor. Ramelteon is a sleep agent medication used to treat sleeplessness (insomnia).
| Supplier | BOC Sciences |
|---|---|
| Product # | 221530-38-7 |
| Pricing | Inquire |
| Cas | 221530-38-7 |
| Molecular Weight | 217.26 |
| Molecular Formula | C13H15NO2 |
| Canonical SMILES | C1CC2=C(C1CC(=O)N)C3=C(C=C2)OCC3 |