Phytic acid solution
Phytic acid (known as inositol hexakisphosphate (IP6), inositol polyphosphate, or phytate when in salt form), discovered in 1903,a saturated cyclic acid, is the principal storage form of phosphorus in many plant tissues, especially bran and seeds.It can be found in cereals and grains.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83-86-3 |
| Pricing | Inquire |
| Cas | 83-86-3 |
| Molecular Weight | 660.04 |
| Molecular Formula | C6H18O24P6 |
| Canonical SMILES | C1(C(C(C(C(C1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O |