4'-C-Methyl-5-methylcytidine
4'-C-Methyl-5-methylcytidine is a highly efficacious nucleoside analog, showcasing remarkable potential in research of RNA viruses including hepatitis C and associated hepatic disorders. By virtue of its exceptional inhibition of viral replication, this compound effectively disrupts viral RNA research and development, thereby impeding viral propagation and rendering it an invaluable tool for the research of various infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 764644-12-4 |
| Pricing | Inquire |
| Cas | 764644-12-4 |
| Molecular Weight | 271.27 |
| Molecular Formula | C11H17N3O5 |
| Canonical SMILES | CC1=CN(C(=O)N=C1N)C2C(C(C(O2)(C)CO)O)O |