N1-MethylpseudoUridine-5'-Triphosphate
N1-MethylpseudoUridine-5'-Triphosphate is a modified NTP for incorporation into messenger RNAs (mRNA) using T7 RNA Polymerase. Incorporation of N1-methylpseudouridine can reduce the immunogenicity of the resulting mRNA. The sodium form N1-MethylpseudoUridine-5'-Triphosphate Sodium (B2706-358101) is in stock.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1428903-59-6 |
| Pricing | Inquire |
| Cas | 1428903-59-6 |
| Molecular Weight | 498.17 |
| Molecular Formula | C10H17N2O15P3 |
| Canonical SMILES | CN1C=C(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |