3'-Azido-3'-deoxyguanosine
3'-Azido-3'-deoxyguanosine is an exceptionally robust antiviral compound meticulously formulated to intricately impede the microbial replication process by precisely directing its attention towards the viral DNA polymerase, disallowing its maleficent progression. Expertly synthesized, this quintessential nucleoside analogue incessantly finds application within the biomedical sector for its unprecedented multiplicity within research domains pertaining to antiviral pharmaceutical evolution and the efficacious research of viral ailments, most notably retroviruses and herpes viruses induced afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-064370 |
| Pricing | Inquire |
| Cas | 98870-11-2 |
| Molecular Weight | 308.25 |
| Molecular Formula | C10H12N8O4 |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)N=[N+]=[N-])O)N=C(NC2=O)N |