9-(b-D-Arabinofuranosyl)-8-chloroadenine
9-(b-D-Arabinofuranosyl)-8-chloroadenine is a highly efficacious antiviral pharmaceutical, exhibiting remarkable potential in research of viral infections originating from the herpes family of viruses. Harnessing its exceptional inhibitory properties against viral DNA enhancement, this compound profoundly impedes viral multiplication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 769872-68-6 |
| Pricing | Inquire |
| Cas | 769872-68-6 |
| Molecular Weight | 301.69 |
| Molecular Formula | C10H12ClN5O4 |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C(=N2)Cl)C3C(C(C(O3)CO)O)O)N |