Fascaplysin chloride
Fascaplysin is a cell-permeable red pigment that acts as an inhibitor of cyclin D kinase 4/cyclin D1 (IC50 = 0.35 μM). It is significantly less selective for Cdk6/cyclin D1 (IC50 = 3.4 μM) and does not inhibit other Cdks and tyrosine kinases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 114719-57-2 |
| Pricing | Inquire |
| Cas | 114719-57-2 |
| Molecular Weight | 306.8 |
| Molecular Formula | C18H11N2O·Cl |
| Canonical SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=[N+](C=C3)C5=CC=CC=C5C4=O.[Cl-] |