Methyl b-neuraminic acid methyl ester
Methyl b-neuraminic acid methyl ester is an intriguing derivative of the remarkable neuraminic acid compound with versatile utilization research spaning the interstellar realm of neurodegenerative afflictions, exemplified by the elusive Alzheimer's disease, while concurrently propelling the distinctive frontier involving compounds specifically aimed at sialic acid-binding proteins.
| Supplier | BOC Sciences |
|---|---|
| Product # | 56070-37-2 |
| Pricing | Inquire |
| Cas | 56070-37-2 |
| Molecular Weight | 295.29 |
| Molecular Formula | C11H21NO8 |
| Canonical SMILES | COC(=O)C1(CC(C(C(O1)C(C(CO)O)O)N)O)OC |