PKR-IN-1
Activator of pyruvate kinase isoenzyme M2 (PKM2), an enzyme involved in glycolysis. Since all tumor cells exclusively express the embryonic M2 isoform of PK, it is hypothesized that PKM2 is a potential target for cancer therapy. Modulation of PKM2 might also be effective in the treatment of obesity, diabetes, autoimmune conditions, and antiproliferation-dependent diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-463157 |
| Pricing | Inquire |
| Cas | 1260075-17-9 |
| Molecular Weight | 450.55 |
| Molecular Formula | C24H26N4O3S |
| Canonical SMILES | C1CC1CN2CCN(CC2)C(=O)C3=CC=C(C=C3)NS(=O)(=O)C4=CC=CC5=C4N=CC=C5 |