PCNA I1
PCNA-I1 is a proliferating cell nuclear antigen (PCNA) inhibitor. It inhibits growth of a range of tumor cell lines in vitro. It induces S and G2/M phase cell cycle arrest in tumor cells with greater efficacy than non-transformed cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 444930-42-1 |
| Pricing | Inquire |
| Cas | 444930-42-1 |
| Molecular Weight | 310.37 |
| Molecular Formula | C17H14N2O2S |
| Canonical SMILES | CC1=C(SC=C1)C(=O)NNC=C2C=CC3=CC=CC=C3C2=O |