2-((tert-Butyldimethylsilyloxy)methyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyr
2-((tert-Butyldimethylsilyloxy)methyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyr is an intricate biomedical compound that significantly contributes to organic synthesis protocols. The biomedical sector leverages its unique properties extensively, particularly in the fabrication of pharmacological interventions targeting a plethora of neurological aberrations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1188927-49-2 |
| Pricing | Inquire |
| Cas | 1188927-49-2 |
| Molecular Weight | 389.37 |
| Molecular Formula | C20H32BNO4Si |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C(O3)CO[Si](C)(C)C(C)(C)C)N=C2 |