N4-Benzoyl-5'-O-DMT-2'-O-methylcytidine
N4-Benzoyl-5'-O-DMT-2'-O-methylcytidine, an influential antiviral agent extensively employed in the biomedical sector, showcases remarkable efficacy in combating RNA viral infections. Its valuable contributions lie in its capacity to combat diverse viral strains, thereby enlightening researchers on viral replication processes and fostering the advancement of groundbreaking antiviral treatments.
Supplier | BOC Sciences |
---|---|
Product # | B2706-338918 |
Pricing | Inquire |
Cas | 110764-74-4 |
Molecular Weight | 663.72 |
Molecular Formula | C38H37N3O8 |
Canonical SMILES | COC1C(C(OC1N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O |