2'-Azido-2'-deoxy-5'-O-DMT-uridine
2'-Azido-2'-deoxy-5'-O-DMT-uridine is a highly intricate compound extensively employed in the realm of biomedicine. By impeding viral replication and fostering the immunological defense against viruses, this compound emerges as a fundamental cornerstone in the advancement of potent antiviral therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 177980-10-8 |
| Pricing | Inquire |
| Cas | 177980-10-8 |
| Molecular Weight | 571.58 |
| Molecular Formula | C30H29N5O7 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(C(C(O4)N5C=CC(=O)NC5=O)N=[N+]=[N-])O |