4-Aminophenyl 2,3,6-tri-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)-b-D-thioglucopyranoside
4-Aminophenyl 2,3,6-tri-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)-b-D-thioglucopyranoside is a remarkable biomedical entity with remarkable pharmacological attributes of acetylglucosamine-based architecture. Furthermore, this extraordinary compound emerges as an invaluable instrument facilitating the comprehensive investigation of carbohydrate-protein interactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 60515-61-9 |
| Pricing | Inquire |
| Cas | 60515-61-9 |
| Molecular Weight | 743.73 |
| Molecular Formula | C32H41NO17S |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC2C(OC(C(C2OC(=O)C)OC(=O)C)SC3=CC=C(C=C3)N)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |