4'-Hydroxy chalcone
4'-Hydroxy chalcone is a chalcone metabolite with diverse biological activities. It is formed when chalcone is metabolized by the cytochrome (CYP) P450 isoform CYP1A1 or CYP2C6. 4'-Hydroxychalcone is a chalone derivative that exhibits moderate to good antiviral activity against tobacco mosaic virus (TMV).
| Supplier | BOC Sciences |
|---|---|
| Product # | 2657-25-2 |
| Pricing | Inquire |
| Cas | 2657-25-2 |
| Molecular Weight | 224.3 |
| Molecular Formula | C15H12O2 |
| Canonical SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)O |