Oseltamivir Acid-[d3]
Oseltamivir Acid-[d3] is the labelled analogue of Oseltamivir Acid, which is a metabolite of Oseltamivir. Oseltamivir is an antiviral medication used to treat and prevent influenza A and influenza B.
Supplier | BOC Sciences |
---|---|
Product # | BLP-003682 |
Pricing | Inquire |
Cas | 1242184-43-5 |
Molecular Weight | 287.37 |
Molecular Formula | C14H21D3N2O4 |
Canonical SMILES | CCC(CC)OC1C=C(CC(C1NC(=O)C)N)C(=O)O |