Fortimicin A
Produced by the strain of Micromonospora olivoasterospora, it has broad antibacterial spectrum and strong antibacterial activity, and is also effective to aminoglycoside antibiotic resistant bacteria producing 3'-phosphotransferase, 2''-nucleoside transferase, 6' and 2'-acetyltransferase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 55779-06-1 |
| Pricing | Inquire |
| Cas | 55779-06-1 |
| Molecular Weight | 405.49 |
| Molecular Formula | C17H35N5O6 |
| Canonical SMILES | CC(C1CCC(C(O1)OC2C(C(C(C(C2O)N(C)C(=O)CN)OC)O)N)N)N |