Destomycin B
Destomycin B is produced by the strain of Streptomyces rimofaciens. It has anti-gram positive bacterium, negative bacterium and fungus activity, adding Destomycin B in a pig feed, it has drive ascaris action.
| Supplier | BOC Sciences |
|---|---|
| Product # | 11005-98-4 |
| Pricing | Inquire |
| Cas | 11005-98-4 |
| Molecular Weight | 541.55 |
| Molecular Formula | C21H39N3O13 |
| Canonical SMILES | CNC1CC(C(C(C1O)OC2C3C(C(C(O2)CO)O)OC4(O3)C(C(C(C(O4)C(CO)N)O)O)O)O)NC |