1-(b-D-Arabinofuranosyl)-5-hydroxymethyluracil
1-(b-D-Arabinofuranosyl)-5-hydroxymethyluracil, commonly referred to as Vidarabine, is a pivotal compound within the biomedical sector. Renowned for its antiviral properties, this medication plays a vital role in combating viral infections induced by herpes simplex and varicella-zoster viruses. By hindering viral DNA synthesis, 1-(b-D-Arabinofuranosyl)-5-hydroxymethyluracil effectively curtails viral replication and propagation.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-338113 |
| Pricing | Inquire |
| Cas | 28608-82-4 |
| Molecular Weight | 274.23 |
| Molecular Formula | C10H14N2O7 |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)CO |