DNA-PK Inhibitor IV
DNA-PK inhibitor IV is an inhibitor of DNA-dependent protein kinase (DNA-PK). It also inhibits the phosphatidylinositol 3-kinase (PI3K) isoforms p110β, p110δ, and p110γ but not p110α or class II PI3Ks, PI4Kβ, ATM, ATR, mTOR, CK2, or GRK2.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70362-07-1 |
| Pricing | Inquire |
| Cas | 70362-07-1 |
| Molecular Weight | 207.23 |
| Molecular Formula | C11H13NO3 |
| Canonical SMILES | C1COCCN1C2=CC(=C(C=C2)C=O)O |