1-(4-(2-Methoxyphenyl)thiazol-2-yl)guanidine Hydrobromide
1-(4-(2-Methoxyphenyl)thiazol-2-yl)guanidine Hydrobromide is used in the preparation of antiulcer agents, specifically 4-Substituted 2-guanidinothiazoles, which are reversible, competitive, and selective inhibitors of gastric H+,K+-ATPase. It is also used in the preparation of guanidinothiazole derivatives as Maillard reaction inhibitors and antioxidants.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB063774 |
| Pricing | Inquire |
| Cas | 123310-81-6 |
| Molecular Weight | 248.30 + (80.91) |
| Molecular Formula | C11H12N4OS·HBr |
| Canonical SMILES | COC1=CC=CC=C1C2=CSC(=N2)N=C(N)N.Br |