2'-Deoxy-5'-O-DMT-2'-fluoro-5-methyluridine
2'-Deoxy-5'-O-DMT-2'-fluoro-5-methyluridine, a paramount compound in the realm of biomedicine, assumes a significant role in the advancement of antiviral drugs and therapies targeting an array of ailments, ranging from viral infections to malignant neoplasms and hereditary disorders. Embodied within its distinctive structural attributes lies robust antiviral efficacy, endowing this compound with immense potential as a hopeful contender for combating viral afflictions like HIV and hepatitis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 133324-02-4 |
| Pricing | Inquire |
| Cas | 133324-02-4 |
| Molecular Weight | 562.59 |
| Molecular Formula | C31H31FN2O7 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O)F |