CP-10
It is a potent PROTAC with specific and significant CDK4 and CDK6 degradation potential, generated by linking the CDK6 inhibitor palbociclib with the E3 ligase CRBN recruiter pomalidomide. It strongly inhibits the proliferation of hematopoietic cancer cells, including multiple myeloma and robustly degraded copy-amplified/mutated forms of CDK6.
| Supplier | BOC Sciences |
|---|---|
| Product # | BP-400095 |
| Pricing | Inquire |
| Cas | 2366268-80-4 |
| Molecular Weight | 871.94 |
| Molecular Formula | C44H49N13O7 |
| Canonical SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N4CCN(CC4)CC5=CN(N=N5)CCOCCNC6=CC=CC7=C6C(=O)N(C7=O)C8CCC(=O)NC8=O)C9CCCC9)C(=O)C |