2-(9-Oxoxanthen-2-yl)propionic Acid 1,8-Diazabicyclo[5.4.0]undec-7-ene Salt
2-(9-Oxoxanthen-2-yl)propionic Acid 1,8-Diazabicyclo[5.4.0]undec-7-ene Salt is an exceptional biomedical agent that showcases inherent complexity in its distinctive therapeutic attributes. Extensively investigated owing to its remarkable competence, this compound emerges as a potential antidote for multifarious ailments, encompassing malignancies and intricate neurological conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1346753-05-6 |
| Pricing | Inquire |
| Cas | 1346753-05-6 |
| Molecular Weight | 420.51 |
| Molecular Formula | C25H28N2O4 |
| Canonical SMILES | CC(C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O)C(=O)O.C1CCC2=NCCCN2CC1 |