Benzyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-a-D-galactopyranoside
Benzyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-a-D-galactopyranoside stands as an indispensable molecule in the realm of biomedicine, fostering exploration into combatting afflictions. By delving into the therapeutic possibilities offered by b-D-galactopyranosyl compounds against myriad pharmacological targets, this agent serves as a catalyst for elucidating the intricacies of drug synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3554-96-9 |
| Pricing | Inquire |
| Cas | 3554-96-9 |
| Molecular Weight | 473.47 |
| Molecular Formula | C21H31NO11 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OCC2=CC=CC=C2)CO)O)OC3C(C(C(C(O3)CO)O)O)O |