5-O-(2-Azido-2-deoxy-D-mannopyranosyl)-uridine
5-O-(2-Azido-2-deoxy-D-mannopyranosyl)-uridine is a biomedical compound used in the research of viral infections like HIV. It possesses antiviral properties due to the incorporation of azido and mannopyranosyl moieties. This compound can selectively inhibit viral replication by interfering with the viral RNA research and development process. Its efficacy and potential make it an essential tool in antiviral research and drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 635293-07-1 |
| Pricing | Inquire |
| Cas | 635293-07-1 |
| Molecular Weight | 431.35 |
| Molecular Formula | C15H21N5O10 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)N=[N+]=[N-])O)O |