3-Chloro-4-fluoro-5-nitrobenzotrifluoride
3-Chloro-4-fluoro-5-nitrobenzotrifluoride can be used as pyrolyl-tRNA synthetase inhibitors. It can also be used to treat various diseases, including nervous and mental disorders and inflammatory diseases, caused by abnormal intracellular signaling, that can include acetylcholine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 101646-02-0 |
| Pricing | Inquire |
| Cas | 101646-02-0 |
| Molecular Weight | 243.54 |
| Molecular Formula | C7H2ClF4NO2 |
| Canonical SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)Cl)C(F)(F)F |