N4-Benzoyl-7'-OH-N-trityl morpholino cytosine
N4-Benzoyl-7'-OH-N-trityl morpholino cytosine is a chemical compound used in biomedical research for its potential as an antiviral agent. It exhibits activity against certain viruses by targeting specific viral enzymes and inhibiting their replication. This compound holds promise in the development of treatments for various viral infections, contributing to advancements in biomedicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 125515-31-3 |
| Pricing | Inquire |
| Cas | 125515-31-3 |
| Molecular Weight | 572.65 |
| Molecular Formula | C35H32N4O4 |
| Canonical SMILES | C1C(OC(CN1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)N5C=CC(=NC5=O)NC(=O)C6=CC=CC=C6)CO |