6-Amino-5-azacytidine
6-Amino-5-azacytidine is a nucleoside that exhibits a growth-inhibitory effect in humans and interferes with the metabolism of purines. 6-Amino-5-azacytidine is also a derivative of 5-Azacytidine, a chemotherapeutic agent used to treat patients with acute myelogenous leukemia.
| Supplier | BOC Sciences |
|---|---|
| Product # | 105331-00-8 |
| Pricing | Inquire |
| Cas | 105331-00-8 |
| Molecular Weight | 259.22 |
| Molecular Formula | C8H13N5O5 |
| Canonical SMILES | C(C1C(C(C(O1)N2C(=NC(=NC2=O)N)N)O)O)O |