Dimethyl 4-methoxy benzylidene malonate
Dimethyl 4-methoxy benzylidene malonate is a widely studied chemical compound in the biomedical sector, exhibits tremendous potential as a therapeutic agent for managing diverse ailments. Research indicates that its application in drug development, targeting precise enzymes or receptors implicated in cancer, inflammation, and neurological disorders, holds significant prospects. This compound, owing to its inherent properties, offers a promising avenue for addressing multifarious maladies persisting in the human body.
| Supplier | BOC Sciences |
|---|---|
| Product # | 7443-25-6 |
| Pricing | Inquire |
| Cas | 7443-25-6 |
| Molecular Weight | 250.24726 |
| Molecular Formula | C13H14O5 |
| Canonical SMILES | COC1=CC=C(C=C1)C=C(C(=O)OC)C(=O)OC |