Citric acid-[2,2,4,4-d4]
Citric acid-[2,2,4,4-d4] is the labelled analogue of citric acid. Citric acid is found in many fruits and vegetables, especially in citrus fruits. It participates in biological process in humans such as citric acid cycle.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011632 |
| Pricing | Inquire |
| Cas | 147664-83-3 |
| Molecular Weight | 196.15 |
| Molecular Formula | C6H4D4O7 |
| Canonical SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O |