Man-7D1 N-Glycan
Man-7D1 N-Glycan is an indispensable compound within the biomedical sector assuming a pivotal position in the investigation and development of a myriad of pharmaceuticals pertaining to glycoproteins and N-glycosylation. This unparalleled product facilitates disease research encompassing cancer, neurodegenerative disorders and autoimmune maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83178-05-6 |
| Pricing | Inquire |
| Cas | 83178-05-6 |
| Molecular Weight | 1559.38 |
| Molecular Formula | C58H98N2O46 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC(C(CO)O)C(C(C=O)NC(=O)C)O)CO)OC2C(C(C(C(O2)COC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)O)O)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)CO)O)O)O)O)O |