Resveratrol-3-O-sulfate sodium salt
Resveratrol-3-O-sulfate is a metabolite of resveratrol. Resveratrol is a stilbenoid, a type of natural phenol, and a phytoalexin produced by several plants in response to injury or, when the plant is under attack by pathogens such as bacteria or fungi.
| Supplier | BOC Sciences |
|---|---|
| Product # | 858127-11-4 |
| Pricing | Inquire |
| Cas | 858127-11-4 |
| Molecular Weight | 330.3 |
| Molecular Formula | C14H11O6S·Na |
| Canonical SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)OS(=O)(=O)[O-])O)O.[Na+] |