Actinopyrone B
Actinopyrone B is an antibiotic isolated from Streptomyces pacttm. Actinopyrone has a relaxing effect on the coronary blood vessels of anesthetized dogs, and has weak anti-gram-positive bacteria and trichoderma activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 88378-60-3 |
| Pricing | Inquire |
| Cas | 88378-60-3 |
| Molecular Weight | 386.52 |
| Molecular Formula | C24H34O4 |
| Canonical SMILES | CC=C(C)C(C(C)C=C(C)C=CCC(=CCC1=C(C(=O)C=C(O1)OC)C)C)O |