Actinopyrone B
Actinopyrone B is an antibiotic isolated from Streptomyces pacttm. Actinopyrone has a relaxing effect on the coronary blood vessels of anesthetized dogs, and has weak anti-gram-positive bacteria and trichoderma activity.
Supplier | BOC Sciences |
---|---|
Product # | 88378-60-3 |
Pricing | Inquire |
Cas | 88378-60-3 |
Molecular Weight | 386.52 |
Molecular Formula | C24H34O4 |
Canonical SMILES | CC=C(C)C(C(C)C=C(C)C=CCC(=CCC1=C(C(=O)C=C(O1)OC)C)C)O |