Longiferone B
Longiferone B is isolated from the Boesenbergia longiflora rhizomes. It showed anti-inflammatory activity against NO release with IC50 value of 21.0µM, and also suppressed the iNOS and COX-2 mRNA expression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1639810-67-5 |
| Pricing | Inquire |
| Cas | 1639810-67-5 |
| Molecular Weight | 218.34 |
| Molecular Formula | C15H22O |
| Canonical SMILES | CC1=CCC2(CCC(C2CC1=O)C(=C)C)C |