2',3',5'-Tri-O-acetyl-cytidine hydrochloride
2',3',5'-Tri-O-acetyl-cytidine hydrochloride, a chemical compound extensively used in biomedical research, is a modification of cytidine acetylated at its 2', 3', and 5' positions. This enhancement elevates the compound's stability and solubility that leads to easier experimental usage. Studies have investigated the efficacy of 2',3',5'-Tri-O-acetyl-cytidine hydrochloride as an effective antiviral therapy for viral infections like HIV and an antitumor drug.
| Supplier | BOC Sciences |
|---|---|
| Product # | 63639-21-4 |
| Pricing | Inquire |
| Cas | 63639-21-4 |
| Molecular Weight | 405.79 |
| Molecular Formula | C15H19N3O8.HCl |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=CC(=NC2=O)N)OC(=O)C)OC(=O)C.Cl |