Denatonium Benzoate Hydrate
Denatonium benzoate is a stimulant of the bitter taste receptors used as aversive agents (bitterants) to prevent inappropriate ingestion. It is used in denatured alcohol, antifreeze, nail biting preventions, respirator mask fit-testing, animal repellents, liquid soaps and shampoos.
| Supplier | BOC Sciences |
|---|---|
| Product # | 86398-53-0 |
| Pricing | Inquire |
| Cas | 86398-53-0 |
| Molecular Weight | 464.60 |
| Molecular Formula | C28H36N2O4 |
| Canonical SMILES | CC[N+](CC)(CC1=CC=CC=C1)CC(=O)NC2=C(C=CC=C2C)C.C1=CC=C(C=C1)C(=O)[O-].O |