Daunorubicin Impurity 8
Daunorubicin Impurity 8 is an impurity of Daunorubicin, which is an anthracycline antibiotic used in the treatment of acute myeloid and lymphocytic leukemia, with adverse reactions such as cardiotoxicity and bone marrow suppression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1010447-40-1 |
| Pricing | Inquire |
| Cas | 1010447-40-1 |
| Molecular Weight | 617.65 |
| Molecular Formula | C34H35NO10 |
| Canonical SMILES | CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)C)O)N)OCC6=CC=CC=C6 |