3-Cumylboronic acid
3-Cumylboronic acid is a vital compound widely used in the biomedical industry. With its exceptional properties, it is employed in the synthesis of pharmaceutical drugs targeting various diseases such as cancer, diabetes, and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 216019-28-2 |
| Pricing | Inquire |
| Cas | 216019-28-2 |
| Molecular Weight | 164.01 |
| Molecular Formula | C9H13BO2 |
| Canonical SMILES | B(C1=CC(=CC=C1)C(C)C)(O)O |