2-Methyl-2-(1-methylbutyl)-propanedioic Acid 1,3-Diethyl Ester
2-Methyl-2-(1-Methylbutyl)-propanedioic Acid 1,3-Diethyl Ester is an intermediate in the synthesis of 2,3-Dimethyl-hexanoic Acid (D473405) which is used to prepare Mono-2,3-dimethylhexyl Phthalate (M539400), a metabolite of Dibutyl phthalate (DBP) (D429495), which is widely used in consumer products.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB059567 |
| Pricing | Inquire |
| Cas | 92155-94-7 |
| Molecular Weight | 244.33 |
| Molecular Formula | C13H24O4 |
| Canonical SMILES | CCCC(C)C(C)(C(=O)OCC)C(=O)OCC |