Apelin-12 (human, bovine, mouse, rat)
Apelin-12 (human, bovine, mouse, rat), an endogenous ligand of the human orphan receptor APJ, lowers arterial blood pressure without altering heart rate in anesthetized rats. Its vasoactive effect may be related to the activation of endothelial nitric oxide synthase.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015270 |
| Pricing | Inquire |
| Cas | 229961-08-4 |
| Molecular Weight | 1422.72 |
| Molecular Formula | C64H103N21O14S |
| Canonical SMILES | CC(C)CC(C(=O)NC(CO)C(=O)NC(CC1=CN=CN1)C(=O)NC(CCCCN)C(=O)NCC(=O)N2CCCC2C(=O)NC(CCSC)C(=O)N3CCCC3C(=O)NC(CC4=CC=CC=C4)C(=O)O)NC(=O)C(CCCN=C(N)N)NC(=O)C5CCCN5C(=O)C(CCCN=C(N)N)N |