2'-Deoxy-5'-O-DMT-N4-Fmoc-5-methylcytidine 3'-CE-phosphoramidite
2'-Deoxy-5'-O-DMT-N4-Fmoc-5-methylcytidine 3'-CE-phosphoramidite, an indispensable biochemical reagent, finds extensive application in the synthesis of modified nucleosides for groundbreaking biomedical research. Its usage is pivotal in the quest for novel drugs and therapies that target specific ailments, including cancer and viral infections. Additionally, this product's significance permeates the realm of nucleic acid chemistry, enabling researchers to delve into the intricacies of DNA and RNA modifications, thereby augmenting drug effectiveness and improving disease detection techniques.
Supplier | BOC Sciences |
---|---|
Product # | 176755-87-6 |
Pricing | Inquire |
Cas | 176755-87-6 |
Molecular Weight | 966.1 |
Molecular Formula | C55H60N5O9P |
Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C5CC(C(O5)COC(C6=CC=CC=C6)(C7=CC=C(C=C7)OC)C8=CC=C(C=C8)OC)OP(N(C(C)C)C(C)C)OCCC#N |