1-(Benzenesulfonyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine
1-(Benzenesulfonyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine, an intricate organic molecule, is primarily deployed in specialized domains of medicinal research. It helps the synthesis of kinase inhibitors and thus promotes the research on the resistance of malignant tumors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 886547-94-0 |
| Pricing | Inquire |
| Cas | 886547-94-0 |
| Molecular Weight | 384.262 |
| Molecular Formula | C19H21BN2O4S |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=C2C=CC=N3)S(=O)(=O)C4=CC=CC=C4 |