Terbutryn-[d5]
Terbutryn-[d5] is a labelled analogue of Terbutryn. Terbutryn is a chemical compound with a triazine ring as a basic structure. It is used as a herbicide. It also acts as an inhibitor of photosynthesis. It is absorbed by the roots and foliage.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004583 |
| Pricing | Inquire |
| Cas | 1219804-47-3 |
| Molecular Weight | 246.39 |
| Molecular Formula | C10H14D5N5S |
| Canonical SMILES | CCNC1=NC(=NC(=N1)SC)NC(C)(C)C |