5'-Azido-2',5'-dideoxycytidine
5'-Azido-2',5'-dideoxycytidine is a powerful antiviral compound widely used in the biomedical industry. It is primarily utilized for the treatment of human immunodeficiency virus (HIV) and Hepatitis B virus (HBV) infections. This nucleoside analog inhibits viral replication by terminating the viral DNA chain. Its potency and selectivity make it an essential tool in antiviral research and drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4803-88-7 |
| Pricing | Inquire |
| Cas | 4803-88-7 |
| Molecular Weight | 252.23 |
| Molecular Formula | C9H12N6O3 |
| Canonical SMILES | C1C(C(OC1N2C=CC(=NC2=O)N)CN=[N+]=[N-])O |