Nexturastat A
Nexturastat A is an aryl urea derivative that acts as a potent and highly selective inhibitor of histone deacetylase 6 (HDAC6) (IC50= 5.02 +/- 0.60 nM). Nexturastat A possesses antiproliferative effects against melanoma cells. Histone deacetylases (HDACs) mediate regulation of gene expression via changes in nucleosome conformation. Dysregulation of histone acetylation can lead to the development of cancers. There is renewed interest in capitalizing new breakthroughs in epigenetic research to address oncology therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1403783-31-2 |
| Pricing | Inquire |
| Cas | 1403783-31-2 |
| Molecular Weight | 341.411 |
| Molecular Formula | C19H23N3O3 |
| Canonical SMILES | CCCCN(CC1=CC=C(C=C1)C(=O)NO)C(=O)NC2=CC=CC=C2 |