2,3-Dihydro-1H-isoindole-4-carboxylic Acid
2,3-Dihydro-1H-isoindole-4-carboxylic Acid is used as a reagent in the synthesis of aminoalkylbenzoic acid derivatives for the treatment of faintness attacks, hypokinesia, cranial disorders, neurodegenerative disorders, depression, anxiety, neuropathic pain, neuropathological disorders and sleep disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB067652 |
| Pricing | Inquire |
| Cas | 658683-13-7 |
| Molecular Weight | 163.17 |
| Molecular Formula | C9H9NO2 |
| Canonical SMILES | C1C2=C(CN1)C(=CC=C2)C(=O)O |