2-Methoxy-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
2-Methoxy-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a key compound used in the biomedical industry. It is utilized in the synthesis of various pharmaceutical drugs targeting specific diseases. This product plays a crucial role in the research and development of novel treatments for various ailments, including but not limited to cancer, inflammation, and central nervous system disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1083168-84-6 |
| Pricing | Inquire |
| Cas | 1083168-84-6 |
| Molecular Weight | 249.12 |
| Molecular Formula | C13H20BNO3 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2OC)C |