| Supplier |
Creative Peptides |
| Product # |
R1938 |
| CAS # |
693-23-2 |
| Pricing |
Inquire
|
| Synonyms |
1,12-Dodecanedioic acid; 1,10-Decanedicarboxylic acid; Decamethylenedicarboxylic acid
|
| MolecularFormula |
C12H22O4
|
| MolecularWeight |
230.3
|
| Storage |
Store at -20° C
|
| Explanation |
Dodecanedioic acid informally referred to as DDDA is a saturated aliphatic dicarboxylic acid mainly used in antiseptics, top-grade coatings, painting materials, corrosion inhibitor, surfactant, and plastics. Experimental work with Dodecanedioic acid in type 2 diabetic patients has demonstrated that IV infusion helps to maintain normal blood sugar and energy levels without increasing the blood glucose load in the process.
|
| InChI |
InChI=1S/C12H22O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h1-10H2,(H,13,14)(H,15,16)
|
| InChIKey |
TVIDDXQYHWJXFK-UHFFFAOYSA-N
|
| CanonicalSMILES |
C(CCCCCC(=O)O)CCCCC(=O)O
|
| Solubility |
Soluble in ethanol (0.1 g/L) at 20° C, hot methanol, and water (0.04 g/L) at 20° C.
|
| Appearance |
Solid
|
| BiologicalActivity |
Dodecanedioic acid is an alpha,omega-dicarboxylic acid that is dodecane in which the methyl groups have been oxidised to the corresponding carboxylic acids. It has a role as an EC 1.1.1.1 (alcohol dehydrogenase) inhibitor and a human metabolite. It is a conjugate acid of a dodecanedioate(2-). It derives from a hydride of a dodecane.
|
| Reference |
- 1. Mingrone, G. et al. 1996. JPEN J Parenter Enteral Nutr. 20(1): 38-42. PMID: 8788261
- 2. Bertuzzi, A. et al. 1997. Br. J. Nutr. 78(1): 143-153. PMID: 9292767
- 3. Greco, A.V. et al. 1997. Clin. Chim. Acta. 258(2): 209-218. PMID: 9074817
- 4. Greco, A.V. et al. 1998. Nutrition. 14(4): 351-357. PMID: 9591306
|