Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate
Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate is a vital compound used in the biomedical industry. This product is utilized in the development of drugs targeting specific diseases such as cancer, inflammation, and neurodegenerative disorders. Its unique structural properties enable it to interact with cellular components, aiding in the drug development of various ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 42245-42-1 |
| Pricing | Inquire |
| Cas | 42245-42-1 |
| Molecular Weight | 208.21 |
| Molecular Formula | C11H12O4 |
| Canonical SMILES | COC1=CC=C(C=C1)C2C(O2)C(=O)OC |